CAS 349110-34-5 appears in our catalog under these names: N-(2,4-difluorophenyl)-2-iodobenzamide, 95%, N-(2,4-Difluorophenyl)-2-iodobenzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
N-(2,4-difluorophenyl)-2-iodobenzamide (CAS 349110-34-5) is a chemical compound with the molecular formula C13H8F2INO and a molecular weight of 359.11 g/mol. IUPAC name: N-(2,4-difluorophenyl)-2-iodobenzamide. InChIKey: NCZSXTZROXXLKS-UHFFFAOYSA-N.
| Molecular formula | C13H8F2INO |
|---|---|
| Molecular weight | 359.11 g/mol |
| IUPAC name | N-(2,4-difluorophenyl)-2-iodobenzamide |
| InChIKey | NCZSXTZROXXLKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=C(C=C(C=C2)F)F)I |
Computed by PubChem (NCBI)