Products 349118-72-5
CAS 349118-72-5 is the registry number for N4-(4-Chloro-3-nitrophenyl)morpholine-4-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
N-(4-chloro-3-nitrophenyl)morpholine-4-carboxamide (CAS 349118-72-5) is a chemical compound with the molecular formula C11H12ClN3O4 and a molecular weight of 285.68 g/mol. IUPAC name: N-(4-chloro-3-nitrophenyl)morpholine-4-carboxamide. InChIKey: UIVPRAHFRZYJAR-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O4 |
|---|---|
| Molecular weight | 285.68 g/mol |
| IUPAC name | N-(4-chloro-3-nitrophenyl)morpholine-4-carboxamide |
| InChIKey | UIVPRAHFRZYJAR-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)NC2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)