CAS 349125-10-6 appears in our catalog under these names: Zopiclone Impurity 8, Zopiclone Impurity 24, Zopiclone Impurity 28, N-(5-Chloro-2-pyridinyl)-2-pyrazinecarboxamide (Zopiclone Impurity), 5-(Chloropyridin-2-yl-carbamoyl)pyrazine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10g, 4x25mg.
N-(5-chloro-2-pyridinyl)pyrazine-2-carboxamide (CAS 349125-10-6) is a chemical compound with the molecular formula C10H7ClN4O and a molecular weight of 234.64 g/mol. IUPAC name: N-(5-chloro-2-pyridinyl)pyrazine-2-carboxamide. InChIKey: BRIYLVGOFCOWPY-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN4O |
|---|---|
| Molecular weight | 234.64 g/mol |
| IUPAC name | N-(5-chloro-2-pyridinyl)pyrazine-2-carboxamide |
| InChIKey | BRIYLVGOFCOWPY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)NC(=O)C2=NC=CN=C2 |
Computed by PubChem (NCBI)