CAS 349125-14-0 appears in our catalog under these names: Edoxaban Impurity 79, Edoxaban Impurity N, Edoxaban Impurity 60, N1,N2-Bis(5-chloro-2-pyridinyl) Ethanediamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g, 500mg.
N,N'-bis(5-chloro-2-pyridinyl)oxamide (CAS 349125-14-0) is a chemical compound with the molecular formula C12H8Cl2N4O2 and a molecular weight of 311.12 g/mol. IUPAC name: N,N'-bis(5-chloro-2-pyridinyl)oxamide. InChIKey: KLUDWSVPLPJUPR-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N4O2 |
|---|---|
| Molecular weight | 311.12 g/mol |
| IUPAC name | N,N'-bis(5-chloro-2-pyridinyl)oxamide |
| InChIKey | KLUDWSVPLPJUPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)NC(=O)C(=O)NC2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)