CAS 34915-06-5 is the registry number for 1,1,1,5,7,7,7-Heptamethyl-3,3,5-tris(trimethylsiloxy)tetrasiloxane. Offered by: TRC. Available pack sizes: 100mg.
[methyl-bis(trimethylsilyloxy)silyl] tris(trimethylsilyl) silicate (CAS 34915-06-5) is a chemical compound with the molecular formula C16H48O6Si7 and a molecular weight of 533.1 g/mol. IUPAC name: [methyl-bis(trimethylsilyloxy)silyl] tris(trimethylsilyl) silicate. InChIKey: LSTVNANFBKAALN-UHFFFAOYSA-N.
| Molecular formula | C16H48O6Si7 |
|---|---|
| Molecular weight | 533.1 g/mol |
| IUPAC name | [methyl-bis(trimethylsilyloxy)silyl] tris(trimethylsilyl) silicate |
| InChIKey | LSTVNANFBKAALN-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
Computed by PubChem (NCBI)