Products 34922-35-5

CAS 34922-35-5 is the registry number for Bis(4-(diphenylamino)phenyl) sulfone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]sulfonylaniline (CAS 34922-35-5) is a chemical compound with the molecular formula C36H28N2O2S and a molecular weight of 552.7 g/mol. IUPAC name: N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]sulfonylaniline. InChIKey: BKHQPMQSPMMQRG-UHFFFAOYSA-N.

Identity
Molecular formulaC36H28N2O2S
Molecular weight552.7 g/mol
IUPAC nameN,N-diphenyl-4-[4-(N-phenylanilino)phenyl]sulfonylaniline
InChIKeyBKHQPMQSPMMQRG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC=C6

Computed by PubChem (NCBI)