CAS 34922-35-5 is the registry number for Bis(4-(diphenylamino)phenyl) sulfone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]sulfonylaniline (CAS 34922-35-5) is a chemical compound with the molecular formula C36H28N2O2S and a molecular weight of 552.7 g/mol. IUPAC name: N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]sulfonylaniline. InChIKey: BKHQPMQSPMMQRG-UHFFFAOYSA-N.
| Molecular formula | C36H28N2O2S |
|---|---|
| Molecular weight | 552.7 g/mol |
| IUPAC name | N,N-diphenyl-4-[4-(N-phenylanilino)phenyl]sulfonylaniline |
| InChIKey | BKHQPMQSPMMQRG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)