CAS 349398-79-4 is the registry number for 1-Benzyl-4-(4-bromophenylsulfonyl)piperazine, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
1-benzyl-4-(4-bromophenyl)sulfonylpiperazine (CAS 349398-79-4) is a chemical compound with the molecular formula C17H19BrN2O2S and a molecular weight of 395.3 g/mol. IUPAC name: 1-benzyl-4-(4-bromophenyl)sulfonylpiperazine. InChIKey: GETTWQGXWARMQE-UHFFFAOYSA-N.
| Molecular formula | C17H19BrN2O2S |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | 1-benzyl-4-(4-bromophenyl)sulfonylpiperazine |
| InChIKey | GETTWQGXWARMQE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=CC=C2)S(=O)(=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)