CAS 349403-14-1 is the registry number for ((2,5-dichlorophenyl)sulfonyl)(2-morpholin-4-ylethyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
2,5-dichloro-N-(2-morpholin-4-ylethyl)benzenesulfonamide (CAS 349403-14-1) is a chemical compound with the molecular formula C12H16Cl2N2O3S and a molecular weight of 339.2 g/mol. IUPAC name: 2,5-dichloro-N-(2-morpholin-4-ylethyl)benzenesulfonamide. InChIKey: JIUOYTWTCLPDQN-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2O3S |
|---|---|
| Molecular weight | 339.2 g/mol |
| IUPAC name | 2,5-dichloro-N-(2-morpholin-4-ylethyl)benzenesulfonamide |
| InChIKey | JIUOYTWTCLPDQN-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCNS(=O)(=O)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)