CAS 349404-77-9 is the registry number for 4–bromo–N–(4–iodophenyl)–benzenesulfonamide. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
4-bromo-N-(4-iodophenyl)benzenesulfonamide (CAS 349404-77-9) is a chemical compound with the molecular formula C12H9BrINO2S and a molecular weight of 438.08 g/mol. IUPAC name: 4-bromo-N-(4-iodophenyl)benzenesulfonamide. InChIKey: JSGNHNGTPIRCJM-UHFFFAOYSA-N.
| Molecular formula | C12H9BrINO2S |
|---|---|
| Molecular weight | 438.08 g/mol |
| IUPAC name | 4-bromo-N-(4-iodophenyl)benzenesulfonamide |
| InChIKey | JSGNHNGTPIRCJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NS(=O)(=O)C2=CC=C(C=C2)Br)I |
Computed by PubChem (NCBI)