Products 34941-89-4

CAS 34941-89-4 is the registry number for 2-Chloro-4,6-difluoropyridine 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-chloro-4,6-difluoropyridine (CAS 34941-89-4) is a chemical compound with the molecular formula C5H2ClF2N and a molecular weight of 149.52 g/mol. IUPAC name: 2-chloro-4,6-difluoropyridine. InChIKey: JXEFDEPVKNFTMR-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2ClF2N
Molecular weight149.52 g/mol
IUPAC name2-chloro-4,6-difluoropyridine
InChIKeyJXEFDEPVKNFTMR-UHFFFAOYSA-N
SMILESC1=C(C=C(N=C1F)Cl)F

Computed by PubChem (NCBI)