CAS 349422-81-7 is the registry number for 1-(3-fluorophenyl)-3-((4-methylphenyl)sulfonyl)urea. Offered by: Biosynth. Available pack sizes: 250mg.
1-(3-fluorophenyl)-3-(4-methylphenyl)sulfonylurea (CAS 349422-81-7) is a chemical compound with the molecular formula C14H13FN2O3S and a molecular weight of 308.33 g/mol. IUPAC name: 1-(3-fluorophenyl)-3-(4-methylphenyl)sulfonylurea. InChIKey: VVUDFMUDFGTWMJ-UHFFFAOYSA-N.
| Molecular formula | C14H13FN2O3S |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-3-(4-methylphenyl)sulfonylurea |
| InChIKey | VVUDFMUDFGTWMJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)