Products 349433-20-1
CAS 349433-20-1 is the registry number for N-(4-Bromo-2-methylphenyl)-3-phenylprop-2-enamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(E)-N-(4-bromo-2-methylphenyl)-3-phenylprop-2-enamide (CAS 349433-20-1) is a chemical compound with the molecular formula C16H14BrNO and a molecular weight of 316.19 g/mol. IUPAC name: (E)-N-(4-bromo-2-methylphenyl)-3-phenylprop-2-enamide. InChIKey: SGPWCTHICBMZRZ-JXMROGBWSA-N.
| Molecular formula | C16H14BrNO |
|---|---|
| Molecular weight | 316.19 g/mol |
| IUPAC name | (E)-N-(4-bromo-2-methylphenyl)-3-phenylprop-2-enamide |
| InChIKey | SGPWCTHICBMZRZ-JXMROGBWSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)NC(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)