CAS 349437-14-5 appears in our catalog under these names: N-(2,4-Difluorophenyl)-3,3-dimethylbutanamide, 95%, N-(2,4-Difluorophenyl)-3,3-dimethylbutanamide, 90%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-(2,4-difluorophenyl)-3,3-dimethylbutanamide (CAS 349437-14-5) is a chemical compound with the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. IUPAC name: N-(2,4-difluorophenyl)-3,3-dimethylbutanamide. InChIKey: GBTGJOHRDNNBDB-UHFFFAOYSA-N.
| Molecular formula | C12H15F2NO |
|---|---|
| Molecular weight | 227.25 g/mol |
| IUPAC name | N-(2,4-difluorophenyl)-3,3-dimethylbutanamide |
| InChIKey | GBTGJOHRDNNBDB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)NC1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)