Products 34946-13-9

CAS 34946-13-9 is the registry number for [2-(Phenylthio)ethyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-phenylsulfanylethylazanium chloride (CAS 34946-13-9) is a chemical compound with the molecular formula C8H12ClNS and a molecular weight of 189.71 g/mol. IUPAC name: 2-phenylsulfanylethylazanium chloride. InChIKey: ZHXISMXDCUJVCY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12ClNS
Molecular weight189.71 g/mol
IUPAC name2-phenylsulfanylethylazanium chloride
InChIKeyZHXISMXDCUJVCY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)SCC[NH3+].[Cl-]

Computed by PubChem (NCBI)