CAS 349536-24-9 is the registry number for 5-Methoxy-4-(4-methoxy-4-oxobutoxy)-2-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 5000mg.
5-methoxy-4-(4-methoxy-4-oxobutoxy)-2-nitrobenzoic acid (CAS 349536-24-9) is a chemical compound with the molecular formula C13H15NO8 and a molecular weight of 313.26 g/mol. IUPAC name: 5-methoxy-4-(4-methoxy-4-oxobutoxy)-2-nitrobenzoic acid. InChIKey: QGSHWDKXHZESNM-UHFFFAOYSA-N.
| Molecular formula | C13H15NO8 |
|---|---|
| Molecular weight | 313.26 g/mol |
| IUPAC name | 5-methoxy-4-(4-methoxy-4-oxobutoxy)-2-nitrobenzoic acid |
| InChIKey | QGSHWDKXHZESNM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])OCCCC(=O)OC |
Computed by PubChem (NCBI)