CAS 349536-39-6 appears in our catalog under these names: 6’-Desmethyl-6’-carboxy Etoricoxib, Etoricoxib Impurity 1, Etoricoxib Impurity L. Offered by: TRC, Chemat Brand. Available pack sizes: 500mg, on request.
5-[5-chloro-3-(4-methylsulfonylphenyl)-2-pyridinyl]pyridine-2-carboxylic acid (CAS 349536-39-6) is a chemical compound with the molecular formula C18H13ClN2O4S and a molecular weight of 388.8 g/mol. IUPAC name: 5-[5-chloro-3-(4-methylsulfonylphenyl)-2-pyridinyl]pyridine-2-carboxylic acid. InChIKey: QIHJKHCGJLIAGS-UHFFFAOYSA-N.
| Molecular formula | C18H13ClN2O4S |
|---|---|
| Molecular weight | 388.8 g/mol |
| IUPAC name | 5-[5-chloro-3-(4-methylsulfonylphenyl)-2-pyridinyl]pyridine-2-carboxylic acid |
| InChIKey | QIHJKHCGJLIAGS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=C(N=CC(=C2)Cl)C3=CN=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)