CAS 349553-74-8 appears in our catalog under these names: N-(4-aminobutyl)-2-nitrobenzene-1-sulfonamide, 97%, 97%, N-(4-Aminobutyl)-2-nitrobenzenesulfonamide hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
N-(4-aminobutyl)-2-nitrobenzenesulfonamide;hydrochloride (CAS 349553-74-8) is a chemical compound with the molecular formula C10H16ClN3O4S and a molecular weight of 309.77 g/mol. IUPAC name: N-(4-aminobutyl)-2-nitrobenzenesulfonamide;hydrochloride. InChIKey: IWCNMIPFYPTQPM-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN3O4S |
|---|---|
| Molecular weight | 309.77 g/mol |
| IUPAC name | N-(4-aminobutyl)-2-nitrobenzenesulfonamide;hydrochloride |
| InChIKey | IWCNMIPFYPTQPM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)NCCCCN.Cl |
Computed by PubChem (NCBI)