Products 349553-88-4
CAS 349553-88-4 appears in our catalog under these names: n-Undecyl-d23 Alcohol, 98 atom % D, min 98% Chemical Purity, 1-Undecanol-d23, 98.2%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 50 mg, 10 mg, 100 mg, 5 mg, 25 mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosadeuterioundecan-1-ol (CAS 349553-88-4) is a chemical compound with the molecular formula C11H24O and a molecular weight of 195.45 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosadeuterioundecan-1-ol. InChIKey: KJIOQYGWTQBHNH-SJTGVFOPSA-N.
| Molecular formula | C11H24O |
|---|---|
| Molecular weight | 195.45 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosadeuterioundecan-1-ol |
| InChIKey | KJIOQYGWTQBHNH-SJTGVFOPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)