Products 349561-46-2
CAS 349561-46-2 is the registry number for SCPI-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-bromophenyl)-5-methoxy-7-nitro-2H-1,2,4-benzoxadiazine (CAS 349561-46-2) is a chemical compound with the molecular formula C14H10BrN3O4 and a molecular weight of 364.15 g/mol. IUPAC name: 3-(4-bromophenyl)-5-methoxy-7-nitro-2H-1,2,4-benzoxadiazine. InChIKey: SZMXFDAAPGEKDK-UHFFFAOYSA-N.
| Molecular formula | C14H10BrN3O4 |
|---|---|
| Molecular weight | 364.15 g/mol |
| IUPAC name | 3-(4-bromophenyl)-5-methoxy-7-nitro-2H-1,2,4-benzoxadiazine |
| InChIKey | SZMXFDAAPGEKDK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1N=C(NO2)C3=CC=C(C=C3)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)