CAS 34999-54-7 is the registry number for Pitavastatin Impurity 86. Offered by: Chemat Brand. Available pack sizes: on request.
(2-aminophenyl)-(4-fluorophenyl)methanol (CAS 34999-54-7) is a chemical compound with the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. IUPAC name: (2-aminophenyl)-(4-fluorophenyl)methanol. InChIKey: LOPJSGXBRZTGIN-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | (2-aminophenyl)-(4-fluorophenyl)methanol |
| InChIKey | LOPJSGXBRZTGIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C2=CC=C(C=C2)F)O)N |
Computed by PubChem (NCBI)