CAS 35010-96-9 appears in our catalog under these names: Z-Pro-gly-nh2, 98%, Z–Pro–Gly–NH2, Z–Pro–Gly–NH₂. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 25g.
Benzyl (2S)-2-[(2-amino-2-oxoethyl)carbamoyl]pyrrolidine-1-carboxylate (CAS 35010-96-9) is a chemical compound with the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. IUPAC name: benzyl (2S)-2-[(2-amino-2-oxoethyl)carbamoyl]pyrrolidine-1-carboxylate. InChIKey: YQHPZEVGWUTGLC-LBPRGKRZSA-N.
| Molecular formula | C15H19N3O4 |
|---|---|
| Molecular weight | 305.33 g/mol |
| IUPAC name | benzyl (2S)-2-[(2-amino-2-oxoethyl)carbamoyl]pyrrolidine-1-carboxylate |
| InChIKey | YQHPZEVGWUTGLC-LBPRGKRZSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)NCC(=O)N |
Computed by PubChem (NCBI)