CAS 35021-16-0 appears in our catalog under these names: ((5-(Dimethylamino)naphthalen-1-yl)sulfonyl)-L-threonine, 98%, Dansyl-Thr-OH 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
(2S,3R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-hydroxybutanoic acid;piperidine (CAS 35021-16-0) is a chemical compound with the molecular formula C21H31N3O5S and a molecular weight of 437.6 g/mol. IUPAC name: (2S,3R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-hydroxybutanoic acid;piperidine. InChIKey: BOLRKZDBAWTVSN-VSLILLSYSA-N.
| Molecular formula | C21H31N3O5S |
|---|---|
| Molecular weight | 437.6 g/mol |
| IUPAC name | (2S,3R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-hydroxybutanoic acid;piperidine |
| InChIKey | BOLRKZDBAWTVSN-VSLILLSYSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NS(=O)(=O)C1=CC=CC2=C1C=CC=C2N(C)C)O.C1CCNCC1 |
Computed by PubChem (NCBI)