CAS 350482-02-9 is the registry number for 5-Amino-4-fluoro-2-methylphenol Sulfate. Offered by: TRC. Available pack sizes: 2,5g.
5-amino-4-fluoro-2-methylphenol;sulfuric acid (CAS 350482-02-9) is a chemical compound with the molecular formula C7H10FNO5S and a molecular weight of 239.22 g/mol. IUPAC name: 5-amino-4-fluoro-2-methylphenol;sulfuric acid. InChIKey: PKTNQSUCNTYVGX-UHFFFAOYSA-N.
| Molecular formula | C7H10FNO5S |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | 5-amino-4-fluoro-2-methylphenol;sulfuric acid |
| InChIKey | PKTNQSUCNTYVGX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1O)N)F.OS(=O)(=O)O |
Computed by PubChem (NCBI)