CAS 350681-33-3 appears in our catalog under these names: Isodemethylwedelolactone/ 99.96% (existing batch purity), 2,4,8,9-Tetrahydroxy-6H-benzofuro[3,2-c][1]benzopyran-6-one, 95%, 95%, Isodemethylwedelolactone, 99.81%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 20mg, 10mg, 25mg, 5 mg, 1 mg, 10 mg.
2,4,8,9-tetrahydroxy-[1]benzofuro[3,2-c]chromen-6-one (CAS 350681-33-3) is a chemical compound with the molecular formula C15H8O7 and a molecular weight of 300.22 g/mol. IUPAC name: 2,4,8,9-tetrahydroxy-[1]benzofuro[3,2-c]chromen-6-one. InChIKey: OBEHELRBTWMPHI-UHFFFAOYSA-N.
| Molecular formula | C15H8O7 |
|---|---|
| Molecular weight | 300.22 g/mol |
| IUPAC name | 2,4,8,9-tetrahydroxy-[1]benzofuro[3,2-c]chromen-6-one |
| InChIKey | OBEHELRBTWMPHI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C3=C(C4=CC(=C(C=C4O3)O)O)C(=O)O2)O)O |
Computed by PubChem (NCBI)