Products 350818-60-9
CAS 350818-60-9 appears in our catalog under these names: 1,2,3,4-Tetramethylbenzene-d14, 98 atom % D, min 97% Chemical Purity, 1,2,3,4-Tetramethylbenzene-d14. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg.
1,2-dideuterio-3,4,5,6-tetrakis(trideuteriomethyl)benzene (CAS 350818-60-9) is a chemical compound with the molecular formula C10H14 and a molecular weight of 148.30 g/mol. IUPAC name: 1,2-dideuterio-3,4,5,6-tetrakis(trideuteriomethyl)benzene. InChIKey: UOHMMEJUHBCKEE-ZVEBFXSZSA-N.
| Molecular formula | C10H14 |
|---|---|
| Molecular weight | 148.30 g/mol |
| IUPAC name | 1,2-dideuterio-3,4,5,6-tetrakis(trideuteriomethyl)benzene |
| InChIKey | UOHMMEJUHBCKEE-ZVEBFXSZSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)