Products 350818-61-0
CAS 350818-61-0 appears in our catalog under these names: 1,2,4-Trimethylbenzene-d12, 98 atom % D, min 98% Chemical Purity, 1,2,4-Trimethylbenzene-d12, >95% (HPLC). Offered by: CDN, TRC. Available pack sizes: 1g, 100mg, 10mg, 50mg.
1,2,4-trideuterio-3,5,6-tris(trideuteriomethyl)benzene (CAS 350818-61-0) is a chemical compound with the molecular formula C9H12 and a molecular weight of 132.26 g/mol. IUPAC name: 1,2,4-trideuterio-3,5,6-tris(trideuteriomethyl)benzene. InChIKey: GWHJZXXIDMPWGX-ZPMNDIOMSA-N.
| Molecular formula | C9H12 |
|---|---|
| Molecular weight | 132.26 g/mol |
| IUPAC name | 1,2,4-trideuterio-3,5,6-tris(trideuteriomethyl)benzene |
| InChIKey | GWHJZXXIDMPWGX-ZPMNDIOMSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)