CAS 350819-37-3 is the registry number for Z–Tyr–OtBu·H2O. Offered by: GLPBio. Available pack sizes: 100g, 25g.
Tert-butyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate;hydrate (CAS 350819-37-3) is a chemical compound with the molecular formula C21H27NO6 and a molecular weight of 389.4 g/mol. IUPAC name: tert-butyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate;hydrate. InChIKey: KLOCNHOHUOPWHZ-FERBBOLQSA-N.
| Molecular formula | C21H27NO6 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | tert-butyl (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate;hydrate |
| InChIKey | KLOCNHOHUOPWHZ-FERBBOLQSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)OCC2=CC=CC=C2.O |
Computed by PubChem (NCBI)