Products 35093-66-4
CAS 35093-66-4 is the registry number for 2,3-Dibromo-6-hydroxy-5-methoxybenzoic acid, 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2,3-dibromo-6-hydroxy-5-methoxybenzoic acid (CAS 35093-66-4) is a chemical compound with the molecular formula C8H6Br2O4 and a molecular weight of 325.94 g/mol. IUPAC name: 2,3-dibromo-6-hydroxy-5-methoxybenzoic acid. InChIKey: FIYWYSUNHCMRRX-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O4 |
|---|---|
| Molecular weight | 325.94 g/mol |
| IUPAC name | 2,3-dibromo-6-hydroxy-5-methoxybenzoic acid |
| InChIKey | FIYWYSUNHCMRRX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1O)C(=O)O)Br)Br |
Computed by PubChem (NCBI)