CAS 350992-13-1 appears in our catalog under these names: Bifeprunox (mesylate), Bifeprunox Mesylate, Bifeprunox Mesylate, >95% (HPLC), Bifeprunox (mesylate), 99.89%. Offered by: GLPBio, Chemat Brand, TRC, TargetMol, MedChemExpress. Available pack sizes: 1mg, on request, 10mg, 25mg, 5mg, 5 mg.
Methanesulfonic acid;7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one (CAS 350992-13-1) is a chemical compound with the molecular formula C25H27N3O5S and a molecular weight of 481.6 g/mol. IUPAC name: methanesulfonic acid;7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one. InChIKey: ONWKHSGOYGLGPO-UHFFFAOYSA-N.
| Molecular formula | C25H27N3O5S |
|---|---|
| Molecular weight | 481.6 g/mol |
| IUPAC name | methanesulfonic acid;7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
| InChIKey | ONWKHSGOYGLGPO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1CN(CCN1CC2=CC(=CC=C2)C3=CC=CC=C3)C4=CC=CC5=C4OC(=O)N5 |
Computed by PubChem (NCBI)