CAS 351-33-7 is the registry number for 2-Chloro-n-(4-chloro-3-trifluoromethyl-phenyl)-acetamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide (CAS 351-33-7) is a chemical compound with the molecular formula C9H6Cl2F3NO and a molecular weight of 272.05 g/mol. IUPAC name: 2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide. InChIKey: SFFFBHOVGWZKNP-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2F3NO |
|---|---|
| Molecular weight | 272.05 g/mol |
| IUPAC name | 2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
| InChIKey | SFFFBHOVGWZKNP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CCl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)