CAS 351027-75-3 is the registry number for N-(2,4,6-Trichlorophenyl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2,4,6-trichlorophenyl)benzenesulfonamide (CAS 351027-75-3) is a chemical compound with the molecular formula C12H8Cl3NO2S and a molecular weight of 336.6 g/mol. IUPAC name: N-(2,4,6-trichlorophenyl)benzenesulfonamide. InChIKey: KVDKXSWOSZISRI-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl3NO2S |
|---|---|
| Molecular weight | 336.6 g/mol |
| IUPAC name | N-(2,4,6-trichlorophenyl)benzenesulfonamide |
| InChIKey | KVDKXSWOSZISRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=C(C=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)