CAS 35106-46-8 is the registry number for 4-(4-Chlorophenyl)-2,2,4-trimethyl-1,2,3,4-tetrahydroquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(4-chlorophenyl)-2,2,4-trimethyl-1,3-dihydroquinoline (CAS 35106-46-8) is a chemical compound with the molecular formula C18H20ClN and a molecular weight of 285.8 g/mol. IUPAC name: 4-(4-chlorophenyl)-2,2,4-trimethyl-1,3-dihydroquinoline. InChIKey: CPOHOSOUXUSHFX-UHFFFAOYSA-N.
| Molecular formula | C18H20ClN |
|---|---|
| Molecular weight | 285.8 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2,2,4-trimethyl-1,3-dihydroquinoline |
| InChIKey | CPOHOSOUXUSHFX-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=CC=CC=C2N1)(C)C3=CC=C(C=C3)Cl)C |
Computed by PubChem (NCBI)