CAS 351066-12-1 is the registry number for N'-(1,1-Dioxido-1,2-benzisothiazol-3-yl)-4-methoxybenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N'-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-methoxybenzenesulfonohydrazide (CAS 351066-12-1) is a chemical compound with the molecular formula C14H13N3O5S2 and a molecular weight of 367.4 g/mol. IUPAC name: N'-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-methoxybenzenesulfonohydrazide. InChIKey: HWXJTKMCUNVJCB-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O5S2 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | N'-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-methoxybenzenesulfonohydrazide |
| InChIKey | HWXJTKMCUNVJCB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NNC2=NS(=O)(=O)C3=CC=CC=C32 |
Computed by PubChem (NCBI)