CAS 351327-32-7 is the registry number for 6-Bromo-2-(4-chlorophenyl)quinoline-4-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-2-(4-chlorophenyl)quinoline-4-carboxylic acid (CAS 351327-32-7) is a chemical compound with the molecular formula C16H9BrClNO2 and a molecular weight of 362.60 g/mol. IUPAC name: 6-bromo-2-(4-chlorophenyl)quinoline-4-carboxylic acid. InChIKey: DLRGQCSCQAFQBF-UHFFFAOYSA-N.
| Molecular formula | C16H9BrClNO2 |
|---|---|
| Molecular weight | 362.60 g/mol |
| IUPAC name | 6-bromo-2-(4-chlorophenyl)quinoline-4-carboxylic acid |
| InChIKey | DLRGQCSCQAFQBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)