CAS 35135-38-7 is the registry number for 2-Hydroxy-3-iodonaphthalene-1,4-dione, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
4-hydroxy-3-iodonaphthalene-1,2-dione (CAS 35135-38-7) is a chemical compound with the molecular formula C10H5IO3 and a molecular weight of 300.05 g/mol. IUPAC name: 4-hydroxy-3-iodonaphthalene-1,2-dione. InChIKey: KDAAEHKHRCUSIF-UHFFFAOYSA-N.
| Molecular formula | C10H5IO3 |
|---|---|
| Molecular weight | 300.05 g/mol |
| IUPAC name | 4-hydroxy-3-iodonaphthalene-1,2-dione |
| InChIKey | KDAAEHKHRCUSIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=O)C2=O)I)O |
Computed by PubChem (NCBI)