CAS 35139-68-5 appears in our catalog under these names: 2,4-Diamine-5,6-Dichloropyrimidine N3-Oxide, Minoxidil Impurity 33, 5,6-Dichloro-3-oxide-2,4-pyrimidinediamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
5,6-dichloro-3-hydroxy-2-iminopyrimidin-4-amine (CAS 35139-68-5) is a chemical compound with the molecular formula C4H4Cl2N4O and a molecular weight of 195.00 g/mol. IUPAC name: 5,6-dichloro-3-hydroxy-2-iminopyrimidin-4-amine. InChIKey: YGASCWNYAKBLHA-UHFFFAOYSA-N.
| Molecular formula | C4H4Cl2N4O |
|---|---|
| Molecular weight | 195.00 g/mol |
| IUPAC name | 5,6-dichloro-3-hydroxy-2-iminopyrimidin-4-amine |
| InChIKey | YGASCWNYAKBLHA-UHFFFAOYSA-N |
| SMILES | C1(=C(N(C(=N)N=C1Cl)O)N)Cl |
Computed by PubChem (NCBI)