CAS 35141-36-7 appears in our catalog under these names: N-Trimethoxysilylpropyl-n,n,n-trimethylammonium chloride, 50% in methanol, 95%, Trimethyl(3–(trimethoxysilyl)propyl)ammonium chloride, N-¬3-(Trimethoxysilyl)propyl|-N,N,N-trimethylammonium chlori, Trimethyl[3-(trimethoxysilyl)propyl]ammonium Chloride (ca. 50% in Methanol), Trimethyl[3-(trimethoxysilyl)propyl]ammonium (chloride) (50% in methanol). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, MedChemExpress. Available pack sizes: 1g, 100g, 25g, 5g, 500g, 10g, 1 g, 500 mg.
Trimethyl(3-trimethoxysilylpropyl)azanium chloride (CAS 35141-36-7) is a chemical compound with the molecular formula C9H24ClNO3Si and a molecular weight of 257.83 g/mol. IUPAC name: trimethyl(3-trimethoxysilylpropyl)azanium chloride. InChIKey: FYZFRYWTMMVDLR-UHFFFAOYSA-M.
| Molecular formula | C9H24ClNO3Si |
|---|---|
| Molecular weight | 257.83 g/mol |
| IUPAC name | trimethyl(3-trimethoxysilylpropyl)azanium chloride |
| InChIKey | FYZFRYWTMMVDLR-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCC[Si](OC)(OC)OC.[Cl-] |
Computed by PubChem (NCBI)