Products 351416-83-6

CAS 351416-83-6 appears in our catalog under these names: 1,4-Dimethyl-1H-pyrrole-3-carboxylic acid, 98%, 1H–Pyrrole–3–carboxylicacid,1,4–dimethyl–(9CI), 1,4-Dimethyl-1H-pyrrole-3-carboxylic acid. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 10g, 200mg, 50mg, 0,5g.

1,4-dimethylpyrrole-3-carboxylic acid (CAS 351416-83-6) is a chemical compound with the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. IUPAC name: 1,4-dimethylpyrrole-3-carboxylic acid. InChIKey: ZBLURRDKXCKUJC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO2
Molecular weight139.15 g/mol
IUPAC name1,4-dimethylpyrrole-3-carboxylic acid
InChIKeyZBLURRDKXCKUJC-UHFFFAOYSA-N
SMILESCC1=CN(C=C1C(=O)O)C

Computed by PubChem (NCBI)