CAS 35150-08-4 appears in our catalog under these names: Boc-Val-NH2, 97%, (S)-tert-Butyl (1-amino-3-methyl-1-oxobutan-2-yl)carbamate, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100g.
Tert-butyl N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamate (CAS 35150-08-4) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: NZSZYROZOXUFSG-ZETCQYMHSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | NZSZYROZOXUFSG-ZETCQYMHSA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)