CAS 351870-31-0 appears in our catalog under these names: 1,10-Phenanthroline Maleimide, 1,10-Phenanthroline Maleimide, ≥96%, ≥96%. Offered by: TRC, Chemat. Available pack sizes: 100mg, 10mg, 5mg.
1-(1,10-phenanthrolin-5-yl)pyrrole-2,5-dione (CAS 351870-31-0) is a chemical compound with the molecular formula C16H9N3O2 and a molecular weight of 275.26 g/mol. IUPAC name: 1-(1,10-phenanthrolin-5-yl)pyrrole-2,5-dione. InChIKey: IXIRFFCTTLSORQ-UHFFFAOYSA-N.
| Molecular formula | C16H9N3O2 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | 1-(1,10-phenanthrolin-5-yl)pyrrole-2,5-dione |
| InChIKey | IXIRFFCTTLSORQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)N4C(=O)C=CC4=O |
Computed by PubChem (NCBI)