CAS 352000-02-3 appears in our catalog under these names: Barium ((2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)methyl phosphate hydrate, 98%, 2,5-Anhydro-D-mannitol-1-phosphate, Barium Salt Hydrate, >95% (HPLC), 2,5-Anhydro-D-mannitol-1-phosphate barium salt hydrate. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 25mg, 50mg, 5mg, 10mg.
Barium(2+);[(2S,3R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl phosphate (CAS 352000-02-3) is a chemical compound with the molecular formula C6H11BaO8P and a molecular weight of 379.45 g/mol. IUPAC name: barium(2+);[(2S,3R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl phosphate. InChIKey: MJAYSUNUPMALNC-RFOBFHBDSA-L.
| Molecular formula | C6H11BaO8P |
|---|---|
| Molecular weight | 379.45 g/mol |
| IUPAC name | barium(2+);[(2S,3R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl phosphate |
| InChIKey | MJAYSUNUPMALNC-RFOBFHBDSA-L |
| SMILES | C([C@H]1C([C@H]([C@@H](O1)COP(=O)([O-])[O-])O)O)O.[Ba+2] |
Computed by PubChem (NCBI)