CAS 3522-50-7 appears in our catalog under these names: Iron(III) Citrate (Technical Grade), Ferric citrate, Ferric citrate, FERRIC CITRATE BIOREAGENT, SUITABLE FOR&, IRON(III) CITRATE, TECHNICAL GRADE. Offered by: TRC, GLPBio, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 25g, 5g, 100mg, 500g, 1000g, 2000g, 25000g, 10000g.
2-hydroxypropane-1,2,3-tricarboxylate;iron(3+) (CAS 3522-50-7) is a chemical compound with the molecular formula C6H5FeO7 and a molecular weight of 244.94 g/mol. IUPAC name: 2-hydroxypropane-1,2,3-tricarboxylate;iron(3+). InChIKey: NPFOYSMITVOQOS-UHFFFAOYSA-K.
| Molecular formula | C6H5FeO7 |
|---|---|
| Molecular weight | 244.94 g/mol |
| IUPAC name | 2-hydroxypropane-1,2,3-tricarboxylate;iron(3+) |
| InChIKey | NPFOYSMITVOQOS-UHFFFAOYSA-K |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[Fe+3] |
Computed by PubChem (NCBI)