CAS 352224-02-3 appears in our catalog under these names: (-)-Sparteine hydroiodide, 95%, (-)-Sparteine hydroiodide, (-)-Sparteine (hydroiodide). Offered by: Combi-blocks, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, Get quote.
(1S,2R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;hydroiodide (CAS 352224-02-3) is a chemical compound with the molecular formula C15H27IN2 and a molecular weight of 362.29 g/mol. IUPAC name: (1S,2R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;hydroiodide. InChIKey: GNYRFSRGJVIYQB-UMEYXWOPSA-N.
| Molecular formula | C15H27IN2 |
|---|---|
| Molecular weight | 362.29 g/mol |
| IUPAC name | (1S,2R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane;hydroiodide |
| InChIKey | GNYRFSRGJVIYQB-UMEYXWOPSA-N |
| SMILES | C1CCN2C[C@@H]3C[C@H]([C@H]2C1)CN4[C@H]3CCCC4.I |
Computed by PubChem (NCBI)