Products 35227-84-0

CAS 35227-84-0 is the registry number for 2,2′-Biphenyldiol, cyclic phosphate. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.

Structural formula: {0} (CAS {1})

6-hydroxybenzo[d][1,3,2]benzodioxaphosphepine 6-oxide (CAS 35227-84-0) is a chemical compound with the molecular formula C12H9O4P and a molecular weight of 248.17 g/mol. IUPAC name: 6-hydroxybenzo[d][1,3,2]benzodioxaphosphepine 6-oxide. InChIKey: RMRHEPZUTYXELS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9O4P
Molecular weight248.17 g/mol
IUPAC name6-hydroxybenzo[d][1,3,2]benzodioxaphosphepine 6-oxide
InChIKeyRMRHEPZUTYXELS-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C3=CC=CC=C3OP(=O)(O2)O

Computed by PubChem (NCBI)