CAS 35227-84-0 is the registry number for 2,2′-Biphenyldiol, cyclic phosphate. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
6-hydroxybenzo[d][1,3,2]benzodioxaphosphepine 6-oxide (CAS 35227-84-0) is a chemical compound with the molecular formula C12H9O4P and a molecular weight of 248.17 g/mol. IUPAC name: 6-hydroxybenzo[d][1,3,2]benzodioxaphosphepine 6-oxide. InChIKey: RMRHEPZUTYXELS-UHFFFAOYSA-N.
| Molecular formula | C12H9O4P |
|---|---|
| Molecular weight | 248.17 g/mol |
| IUPAC name | 6-hydroxybenzo[d][1,3,2]benzodioxaphosphepine 6-oxide |
| InChIKey | RMRHEPZUTYXELS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3OP(=O)(O2)O |
Computed by PubChem (NCBI)