Products 352431-07-3
CAS 352431-07-3 is the registry number for Bis(2-hydroxyethyl)-1,1,2,2-d4-amine, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
1,1,2,2-tetradeuterio-2-(2-hydroxyethylamino)ethanol;hydrochloride (CAS 352431-07-3) is a chemical compound with the molecular formula C4H12ClNO2 and a molecular weight of 145.62 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(2-hydroxyethylamino)ethanol;hydrochloride. InChIKey: VJLOFJZWUDZJBX-HAFGEVJTSA-N.
| Molecular formula | C4H12ClNO2 |
|---|---|
| Molecular weight | 145.62 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(2-hydroxyethylamino)ethanol;hydrochloride |
| InChIKey | VJLOFJZWUDZJBX-HAFGEVJTSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)NCCO.Cl |
Computed by PubChem (NCBI)