Products 352431-09-5
CAS 352431-09-5 is the registry number for 1-Butane-d9-thiol, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1,1,2,2,3,3,4,4,4-nonadeuteriobutane-1-thiol (CAS 352431-09-5) is a chemical compound with the molecular formula C4H10S and a molecular weight of 99.24 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4-nonadeuteriobutane-1-thiol. InChIKey: WQAQPCDUOCURKW-YNSOAAEFSA-N.
| Molecular formula | C4H10S |
|---|---|
| Molecular weight | 99.24 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,4-nonadeuteriobutane-1-thiol |
| InChIKey | WQAQPCDUOCURKW-YNSOAAEFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])S |
Computed by PubChem (NCBI)