Products 352431-21-1
CAS 352431-21-1 appears in our catalog under these names: 4-n-Propylphenol-d12, 98 atom % D, min 98% Chemical Purity, 4-Propylphenol-d12. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 5 mg, 10 mg.
1,2,4,5-tetradeuterio-3-deuteriooxy-6-(1,1,2,2,3,3,3-heptadeuteriopropyl)benzene (CAS 352431-21-1) is a chemical compound with the molecular formula C9H12O and a molecular weight of 148.26 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3-deuteriooxy-6-(1,1,2,2,3,3,3-heptadeuteriopropyl)benzene. InChIKey: KLSLBUSXWBJMEC-GCCALJRQSA-N.
| Molecular formula | C9H12O |
|---|---|
| Molecular weight | 148.26 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3-deuteriooxy-6-(1,1,2,2,3,3,3-heptadeuteriopropyl)benzene |
| InChIKey | KLSLBUSXWBJMEC-GCCALJRQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])[2H])[2H])O[2H])[2H] |
Computed by PubChem (NCBI)