CAS 352431-23-3 is the registry number for p-Toluidine-d9, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
N,N,2,3,5,6-hexadeuterio-4-(trideuteriomethyl)aniline (CAS 352431-23-3) is a chemical compound with the molecular formula C7H9N and a molecular weight of 116.21 g/mol. IUPAC name: N,N,2,3,5,6-hexadeuterio-4-(trideuteriomethyl)aniline. InChIKey: RZXMPPFPUUCRFN-LLZDZVHOSA-N.
| Molecular formula | C7H9N |
|---|---|
| Molecular weight | 116.21 g/mol |
| IUPAC name | N,N,2,3,5,6-hexadeuterio-4-(trideuteriomethyl)aniline |
| InChIKey | RZXMPPFPUUCRFN-LLZDZVHOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])N([2H])[2H])[2H] |
Computed by PubChem (NCBI)