Products 352431-46-0
CAS 352431-46-0 appears in our catalog under these names: 2,3-Pentanedione-1,1,1,4,4-d5, 2,3-Pentanedione-1,1,1,4,4-d5, 98 atom % D, min 98% Chemical Purity, 2,3-Pentanedione-d5. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 0,5g, 0,25g, 25 mg, 10 mg, 100 mg.
1,1,1,4,4-pentadeuteriopentane-2,3-dione (CAS 352431-46-0) is a chemical compound with the molecular formula C5H8O2 and a molecular weight of 105.15 g/mol. IUPAC name: 1,1,1,4,4-pentadeuteriopentane-2,3-dione. InChIKey: TZMFJUDUGYTVRY-PDWRLMEDSA-N.
| Molecular formula | C5H8O2 |
|---|---|
| Molecular weight | 105.15 g/mol |
| IUPAC name | 1,1,1,4,4-pentadeuteriopentane-2,3-dione |
| InChIKey | TZMFJUDUGYTVRY-PDWRLMEDSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C(=O)C([2H])([2H])C |
Computed by PubChem (NCBI)