Products 352431-55-1
CAS 352431-55-1 appears in our catalog under these names: 1-Chloroadamantane-d15, 1-Chloroadamantane-d15, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,05g, 0,01g.
1-chloro-2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane (CAS 352431-55-1) is a chemical compound with the molecular formula C10H15Cl and a molecular weight of 185.77 g/mol. IUPAC name: 1-chloro-2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane. InChIKey: OZNXTQSXSHODFR-BXSQCBKHSA-N.
| Molecular formula | C10H15Cl |
|---|---|
| Molecular weight | 185.77 g/mol |
| IUPAC name | 1-chloro-2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane |
| InChIKey | OZNXTQSXSHODFR-BXSQCBKHSA-N |
| SMILES | [2H]C1(C2(C(C3(C(C1(C(C(C2([2H])[2H])(C3([2H])[2H])Cl)([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)